C19H27NO5 — CID 57309325
ethyl 2-[3-(4-acetamidophenoxy)-4-hydroxycyclohexyl]propanoate (PubChem CID 57309325) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 2-[3-(4-acetamidophenoxy)-4-hydroxycyclohexyl]propanoate.
| Compound Name | ethyl 2-[3-(4-acetamidophenoxy)-4-hydroxycyclohexyl]propanoate |
|---|---|
| PubChem CID | 57309325 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | ethyl 2-[3-(4-acetamidophenoxy)-4-hydroxycyclohexyl]propanoate |
| SMILES | CCOC(=O)C(C)C1CCC(O)C(Oc2ccc(NC(C)=O)cc2)C1 |
| InChI | InChI=1S/C19H27NO5/c1-4-24-19(23)12(2)14-5-10-17(22)18(11-14)25-16-8-6-15(7-9-16)20-13(3)21/h6-9,12,14,17-18,22H,4-5,10-11H2,1-3H3,(H,20,21) |
| InChIKey | OASOKQUESUEPQJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |