C17H25NO4 — CID 95772065
(2R)-2-ethoxy-N-[4-[(1S,2S)-2-hydroxycyclohexyl]oxyphenyl]propanamide (PubChem CID 95772065) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-[4-[(1S,2S)-2-hydroxycyclohexyl]oxyphenyl]propanamide.
| Compound Name | (2R)-2-ethoxy-N-[4-[(1S,2S)-2-hydroxycyclohexyl]oxyphenyl]propanamide |
|---|---|
| PubChem CID | 95772065 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (2R)-2-ethoxy-N-[4-[(1S,2S)-2-hydroxycyclohexyl]oxyphenyl]propanamide |
| SMILES | CCO[C@H](C)C(=O)Nc1ccc(O[C@H]2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H25NO4/c1-3-21-12(2)17(20)18-13-8-10-14(11-9-13)22-16-7-5-4-6-15(16)19/h8-12,15-16,19H,3-7H2,1-2H3,(H,18,20)/t12-,15+,16+/m1/s1 |
| InChIKey | ZJQYZOVVWVQTLT-KCXAZCMYSA-N |
| XLogP | 2.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |