C19H28N2O4 — CID 120794064
2-amino-N-[4-(2-hydroxycyclohexyl)oxyphenyl]-2-(oxan-4-yl)acetamide (PubChem CID 120794064) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-amino-N-[4-(2-hydroxycyclohexyl)oxyphenyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[4-(2-hydroxycyclohexyl)oxyphenyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120794064 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-amino-N-[4-(2-hydroxycyclohexyl)oxyphenyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)Nc1ccc(OC2CCCCC2O)cc1)C1CCOCC1 |
| InChI | InChI=1S/C19H28N2O4/c20-18(13-9-11-24-12-10-13)19(23)21-14-5-7-15(8-6-14)25-17-4-2-1-3-16(17)22/h5-8,13,16-18,22H,1-4,9-12,20H2,(H,21,23) |
| InChIKey | GFKYMHZHUUMQEW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |