C19H27N3O3 — CID 120786530
4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-cyclopentylbenzamide (PubChem CID 120786530) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-cyclopentylbenzamide.
| Compound Name | 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-cyclopentylbenzamide |
|---|---|
| PubChem CID | 120786530 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-cyclopentylbenzamide |
| SMILES | NC(C(=O)Nc1ccc(C(=O)NC2CCCC2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C19H27N3O3/c20-17(13-9-11-25-12-10-13)19(24)22-16-7-5-14(6-8-16)18(23)21-15-3-1-2-4-15/h5-8,13,15,17H,1-4,9-12,20H2,(H,21,23)(H,22,24) |
| InChIKey | UFTZOUOUQYQNPK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |