C21H24FN3O3 — CID 120786924
4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 120786924) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 120786924 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[[2-amino-2-(oxan-4-yl)acetyl]amino]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | NC(C(=O)Nc1ccc(C(=O)NCc2ccc(F)cc2)cc1)C1CCOCC1 |
| InChI | InChI=1S/C21H24FN3O3/c22-17-5-1-14(2-6-17)13-24-20(26)16-3-7-18(8-4-16)25-21(27)19(23)15-9-11-28-12-10-15/h1-8,15,19H,9-13,23H2,(H,24,26)(H,25,27) |
| InChIKey | VGHFAYZHYREHCV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |