C12H16O3S — CID 13212964
trans-(1R,2R)-2-(4-methylphenyl)sulfonylcyclopentan-1-ol (PubChem CID 13212964) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-methylphenyl)sulfonylcyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(4-methylphenyl)sulfonylcyclopentan-1-ol |
|---|---|
| PubChem CID | 13212964 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | trans-(1R,2R)-2-(4-methylphenyl)sulfonylcyclopentan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C12H16O3S/c1-9-5-7-10(8-6-9)16(14,15)12-4-2-3-11(12)13/h5-8,11-13H,2-4H2,1H3/t11-,12-/m1/s1 |
| InChIKey | USLOADSOSCMUEP-VXGBXAGGSA-N |
| XLogP | 1.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |