C13H17NO3S — CID 102032381
(1S,2R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-2-ol (PubChem CID 102032381) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is (1S,2R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-2-ol.
| Compound Name | (1S,2R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-2-ol |
|---|---|
| PubChem CID | 102032381 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (1S,2R,6S)-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3[C@H](O)CCC[C@@H]32)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-9-5-7-10(8-6-9)18(16,17)14-11-3-2-4-12(15)13(11)14/h5-8,11-13,15H,2-4H2,1H3/t11-,12+,13-,14?/m0/s1 |
| InChIKey | AAXAVRIAYUXVAW-WJLOJVBCSA-N |
| XLogP | 1.28 |
| TPSA | 57.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|