C11H15NO2S — CID 11218386
2,3-dimethyl-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 11218386) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | 2,3-dimethyl-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 11218386 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,3-dimethyl-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C(C)C2C)cc1 |
| InChI | InChI=1S/C11H15NO2S/c1-8-4-6-11(7-5-8)15(13,14)12-9(2)10(12)3/h4-7,9-10H,1-3H3 |
| InChIKey | RIWAOCZPZARVOZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|