C27H27N3O6S3 — CID 12599640
(2Z,5Z,8Z)-1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonine (PubChem CID 12599640) has the molecular formula C27H27N3O6S3 and a molecular weight of 585.73 g/mol. Its IUPAC name is (2Z,5Z,8Z)-1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonine.
| Compound Name | (2Z,5Z,8Z)-1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonine |
|---|---|
| PubChem CID | 12599640 |
| Molecular Formula | C27H27N3O6S3 |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | (2Z,5Z,8Z)-1,4,7-tris-(4-methylphenyl)sulfonyl-1,4,7-triazonine |
| SMILES | Cc1ccc(S(=O)(=O)N2/C=C\N(S(=O)(=O)c3ccc(C)cc3)/C=C\N(S(=O)(=O)c3ccc(C)cc3)/C=C\2)cc1 |
| InChI | InChI=1S/C27H27N3O6S3/c1-22-4-10-25(11-5-22)37(31,32)28-16-18-29(38(33,34)26-12-6-23(2)7-13-26)20-21-30(19-17-28)39(35,36)27-14-8-24(3)9-15-27/h4-21H,1-3H3/b18-16-,19-17-,21-20- |
| InChIKey | SHOXGURQIZZMCK-GGMXKNSESA-N |
| XLogP | 4.41 |
| TPSA | 112.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |