C27H27N3O6S3 — CID 12599628
3,6,9-tris-(4-methylphenyl)sulfonyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonane (PubChem CID 12599628) has the molecular formula C27H27N3O6S3 and a molecular weight of 585.73 g/mol. Its IUPAC name is 3,6,9-tris-(4-methylphenyl)sulfonyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonane.
| Compound Name | 3,6,9-tris-(4-methylphenyl)sulfonyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonane |
|---|---|
| PubChem CID | 12599628 |
| Molecular Formula | C27H27N3O6S3 |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.11 |
| IUPAC Name | 3,6,9-tris-(4-methylphenyl)sulfonyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonane |
| SMILES | Cc1ccc(S(=O)(=O)N2C3C4C(C5C(C32)N5S(=O)(=O)c2ccc(C)cc2)N4S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H27N3O6S3/c1-16-4-10-19(11-5-16)37(31,32)28-22-23(28)25-27(30(25)39(35,36)21-14-8-18(3)9-15-21)26-24(22)29(26)38(33,34)20-12-6-17(2)7-13-20/h4-15,22-27H,1-3H3 |
| InChIKey | CRTRVVKKHRLSFB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|