C14H17NO2S — CID 11471038
(1S,2R,4R,5R)-3-(4-methylphenyl)sulfonyl-3-azatricyclo[3.2.1.02,4]octane (PubChem CID 11471038) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is (1S,2R,4R,5R)-3-(4-methylphenyl)sulfonyl-3-azatricyclo[3.2.1.02,4]octane.
| Compound Name | (1S,2R,4R,5R)-3-(4-methylphenyl)sulfonyl-3-azatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 11471038 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | (1S,2R,4R,5R)-3-(4-methylphenyl)sulfonyl-3-azatricyclo[3.2.1.02,4]octane |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3[C@@H]4CC[C@@H](C4)[C@H]32)cc1 |
| InChI | InChI=1S/C14H17NO2S/c1-9-2-6-12(7-3-9)18(16,17)15-13-10-4-5-11(8-10)14(13)15/h2-3,6-7,10-11,13-14H,4-5,8H2,1H3/t10-,11+,13-,14-,15?/m1/s1 |
| InChIKey | WMPOHMVSFCYBPX-AARLDXMQSA-N |
| XLogP | 2.17 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|