C14H19NO3S — CID 101370816
(1S,2R,6S)-2-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane (PubChem CID 101370816) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is (1S,2R,6S)-2-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane.
| Compound Name | (1S,2R,6S)-2-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 101370816 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (1S,2R,6S)-2-methoxy-7-(4-methylphenyl)sulfonyl-7-azabicyclo[4.1.0]heptane |
| SMILES | CO[C@@H]1CCC[C@H]2[C@@H]1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19NO3S/c1-10-6-8-11(9-7-10)19(16,17)15-12-4-3-5-13(18-2)14(12)15/h6-9,12-14H,3-5H2,1-2H3/t12-,13+,14-,15?/m0/s1 |
| InChIKey | NTKANFYFRMJXOA-MBOZISHXSA-N |
| XLogP | 1.94 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|