C15H22O3S — CID 11781005
1-[[(1S,2R)-2-methoxycyclohexyl]methylsulfonyl]-4-methylbenzene (PubChem CID 11781005) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is 1-[[(1S,2R)-2-methoxycyclohexyl]methylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[[(1S,2R)-2-methoxycyclohexyl]methylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 11781005 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-[[(1S,2R)-2-methoxycyclohexyl]methylsulfonyl]-4-methylbenzene |
| SMILES | CO[C@@H]1CCCC[C@@H]1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22O3S/c1-12-7-9-14(10-8-12)19(16,17)11-13-5-3-4-6-15(13)18-2/h7-10,13,15H,3-6,11H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | RDZUKVIPVGEVSX-UKRRQHHQSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |