About 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile
2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile (PubChem CID 131848305) has the molecular formula C15H19NO2S
and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile |
| PubChem CID | 131848305 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2CCC[C@H]2CC#N)cc1 |
| InChI | InChI=1S/C15H19NO2S/c1-12-5-7-15(8-6-12)19(17,18)11-14-4-2-3-13(14)9-10-16/h5-8,13-14H,2-4,9,11H2,1H3/t13-,14-/m0/s1 |
| InChIKey | YLIRGMJGNYBPNL-KBPBESRZSA-N |
| XLogP | 3.10 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile?
The IUPAC name of 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile (CID 131848305) is 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile.
What is the SMILES notation for 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile?
The canonical SMILES for 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile is Cc1ccc(S(=O)(=O)C[C@@H]2CCC[C@H]2CC#N)cc1.
What is the InChIKey of 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile?
The InChIKey is YLIRGMJGNYBPNL-KBPBESRZSA-N. The full InChI is InChI=1S/C15H19NO2S/c1-12-5-7-15(8-6-12)19(17,18)11-14-4-2-3-13(14)9-10-16/h5-8,13-14H,2-4,9,11H2,1H3/t13-,14-/m0/s1.
What are the key properties of 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile?
2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile has a molecular weight of 277.39 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]acetonitrile is sourced from PubChem (CID 131848305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).