C15H22O2S — CID 157322194
1-methyl-4-[[(1R,2R)-2-methylcyclohexyl]methylsulfonyl]benzene (PubChem CID 157322194) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 1-methyl-4-[[(1R,2R)-2-methylcyclohexyl]methylsulfonyl]benzene.
| Compound Name | 1-methyl-4-[[(1R,2R)-2-methylcyclohexyl]methylsulfonyl]benzene |
|---|---|
| PubChem CID | 157322194 |
| Molecular Formula | C15H22O2S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-methyl-4-[[(1R,2R)-2-methylcyclohexyl]methylsulfonyl]benzene |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C15H22O2S/c1-12-7-9-15(10-8-12)18(16,17)11-14-6-4-3-5-13(14)2/h7-10,13-14H,3-6,11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | AUNWERPCGHLPEB-KGLIPLIRSA-N |
| XLogP | 3.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |