C11H12Cl2O2S — CID 748157
1-[[(1R)-2,2-dichlorocyclopropyl]methylsulfonyl]-4-methylbenzene (PubChem CID 748157) has the molecular formula C11H12Cl2O2S and a molecular weight of 279.19 g/mol. Its IUPAC name is 1-[[(1R)-2,2-dichlorocyclopropyl]methylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[[(1R)-2,2-dichlorocyclopropyl]methylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 748157 |
| Molecular Formula | C11H12Cl2O2S |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 1-[[(1R)-2,2-dichlorocyclopropyl]methylsulfonyl]-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H]2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C11H12Cl2O2S/c1-8-2-4-10(5-3-8)16(14,15)7-9-6-11(9,12)13/h2-5,9H,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | MTKHGJFAJVWPKU-SECBINFHSA-N |
| XLogP | 2.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|