C10H10Br2O2S — CID 611296
(2,2-dibromocyclopropyl)methylsulfonylbenzene (PubChem CID 611296) has the molecular formula C10H10Br2O2S and a molecular weight of 354.06 g/mol. Its IUPAC name is (2,2-dibromocyclopropyl)methylsulfonylbenzene.
| Compound Name | (2,2-dibromocyclopropyl)methylsulfonylbenzene |
|---|---|
| PubChem CID | 611296 |
| Molecular Formula | C10H10Br2O2S |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | (2,2-dibromocyclopropyl)methylsulfonylbenzene |
| SMILES | O=S(=O)(CC1CC1(Br)Br)c1ccccc1 |
| InChI | InChI=1S/C10H10Br2O2S/c11-10(12)6-8(10)7-15(13,14)9-4-2-1-3-5-9/h1-5,8H,6-7H2 |
| InChIKey | RLAGGYVQBPBNDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|