C12H16O4S — CID 102377373
2-(benzenesulfonylmethyl)-1,3-dioxepane (PubChem CID 102377373) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1,3-dioxepane.
| Compound Name | 2-(benzenesulfonylmethyl)-1,3-dioxepane |
|---|---|
| PubChem CID | 102377373 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1,3-dioxepane |
| SMILES | O=S(=O)(CC1OCCCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H16O4S/c13-17(14,11-6-2-1-3-7-11)10-12-15-8-4-5-9-16-12/h1-3,6-7,12H,4-5,8-10H2 |
| InChIKey | GNFQKHVBIILROJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |