C14H20O3S — CID 102009091
(2R,7S)-2-(benzenesulfonylmethyl)-7-methyloxepane (PubChem CID 102009091) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (2R,7S)-2-(benzenesulfonylmethyl)-7-methyloxepane.
| Compound Name | (2R,7S)-2-(benzenesulfonylmethyl)-7-methyloxepane |
|---|---|
| PubChem CID | 102009091 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2R,7S)-2-(benzenesulfonylmethyl)-7-methyloxepane |
| SMILES | C[C@H]1CCCC[C@H](CS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H20O3S/c1-12-7-5-6-8-13(17-12)11-18(15,16)14-9-3-2-4-10-14/h2-4,9-10,12-13H,5-8,11H2,1H3/t12-,13+/m0/s1 |
| InChIKey | YXJBADUYVYLLND-QWHCGFSZSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |