C15H20F2O4S — CID 10688148
2-[2-(benzenesulfonyl)-1,1-difluoropentyl]-1,4-dioxane (PubChem CID 10688148) has the molecular formula C15H20F2O4S and a molecular weight of 334.38 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-1,1-difluoropentyl]-1,4-dioxane.
| Compound Name | 2-[2-(benzenesulfonyl)-1,1-difluoropentyl]-1,4-dioxane |
|---|---|
| PubChem CID | 10688148 |
| Molecular Formula | C15H20F2O4S |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-1,1-difluoropentyl]-1,4-dioxane |
| SMILES | CCCC(C(F)(F)C1COCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20F2O4S/c1-2-6-14(15(16,17)13-11-20-9-10-21-13)22(18,19)12-7-4-3-5-8-12/h3-5,7-8,13-14H,2,6,9-11H2,1H3 |
| InChIKey | ZKLOQUHTOJCJRU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |