C13H16F2O4S — CID 10542679
2-[2-(benzenesulfonyl)-1,1-difluoropropyl]-1,4-dioxane (PubChem CID 10542679) has the molecular formula C13H16F2O4S and a molecular weight of 306.33 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-1,1-difluoropropyl]-1,4-dioxane.
| Compound Name | 2-[2-(benzenesulfonyl)-1,1-difluoropropyl]-1,4-dioxane |
|---|---|
| PubChem CID | 10542679 |
| Molecular Formula | C13H16F2O4S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-1,1-difluoropropyl]-1,4-dioxane |
| SMILES | CC(C(F)(F)C1COCCO1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16F2O4S/c1-10(13(14,15)12-9-18-7-8-19-12)20(16,17)11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | QDPSICZPOSSSNU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |