C12H11F5O3S — CID 10520431
[(E)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylbenzene (PubChem CID 10520431) has the molecular formula C12H11F5O3S and a molecular weight of 330.27 g/mol. Its IUPAC name is [(E)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylbenzene.
| Compound Name | [(E)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10520431 |
| Molecular Formula | C12H11F5O3S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | [(E)-2-ethoxy-3,3,4,4,4-pentafluorobut-1-enyl]sulfonylbenzene |
| SMILES | CCO/C(=C/S(=O)(=O)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F5O3S/c1-2-20-10(11(13,14)12(15,16)17)8-21(18,19)9-6-4-3-5-7-9/h3-8H,2H2,1H3/b10-8+ |
| InChIKey | OQDIVLIULXFUMG-CSKARUKUSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|