C18H18F2O4S — CID 10619015
2-[2-(benzenesulfonyl)-1,1-difluoro-2-phenylethyl]-1,4-dioxane (PubChem CID 10619015) has the molecular formula C18H18F2O4S and a molecular weight of 368.40 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)-1,1-difluoro-2-phenylethyl]-1,4-dioxane.
| Compound Name | 2-[2-(benzenesulfonyl)-1,1-difluoro-2-phenylethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 10619015 |
| Molecular Formula | C18H18F2O4S |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[2-(benzenesulfonyl)-1,1-difluoro-2-phenylethyl]-1,4-dioxane |
| SMILES | O=S(=O)(c1ccccc1)C(c1ccccc1)C(F)(F)C1COCCO1 |
| InChI | InChI=1S/C18H18F2O4S/c19-18(20,16-13-23-11-12-24-16)17(14-7-3-1-4-8-14)25(21,22)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2 |
| InChIKey | SPKREQPEQFMQSZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |