C14H17F3O3S — CID 118445107
2,4-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane (PubChem CID 118445107) has the molecular formula C14H17F3O3S and a molecular weight of 322.35 g/mol. Its IUPAC name is 2,4-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane.
| Compound Name | 2,4-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
|---|---|
| PubChem CID | 118445107 |
| Molecular Formula | C14H17F3O3S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2,4-dimethyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxane |
| SMILES | CC1CC(C)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C14H17F3O3S/c1-10-9-13(2,6-7-20-10)21(18,19)12-5-3-4-11(8-12)14(15,16)17/h3-5,8,10H,6-7,9H2,1-2H3 |
| InChIKey | ZMNXPGLCKUJBDA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |