C13H15F3O3SSe — CID 139188981
(2S,3R)-3-(4-methylphenyl)sulfonyl-2-(trifluoromethylselanyl)oxane (PubChem CID 139188981) has the molecular formula C13H15F3O3SSe and a molecular weight of 387.28 g/mol. Its IUPAC name is (2S,3R)-3-(4-methylphenyl)sulfonyl-2-(trifluoromethylselanyl)oxane.
| Compound Name | (2S,3R)-3-(4-methylphenyl)sulfonyl-2-(trifluoromethylselanyl)oxane |
|---|---|
| PubChem CID | 139188981 |
| Molecular Formula | C13H15F3O3SSe |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | (2S,3R)-3-(4-methylphenyl)sulfonyl-2-(trifluoromethylselanyl)oxane |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CCCO[C@H]2[Se]C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H15F3O3SSe/c1-9-4-6-10(7-5-9)20(17,18)11-3-2-8-19-12(11)21-13(14,15)16/h4-7,11-12H,2-3,8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | ZUYDEXVMEMQLIA-NEPJUHHUSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|