C12H13F3O2S — CID 134928163
(2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,2-trifluoroethyl)oxirane (PubChem CID 134928163) has the molecular formula C12H13F3O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,2-trifluoroethyl)oxirane.
| Compound Name | (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,2-trifluoroethyl)oxirane |
|---|---|
| PubChem CID | 134928163 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2R)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-(2,2,2-trifluoroethyl)oxirane |
| SMILES | Cc1ccc([S@](=O)C[C@@]2(CC(F)(F)F)CO2)cc1 |
| InChI | InChI=1S/C12H13F3O2S/c1-9-2-4-10(5-3-9)18(16)8-11(7-17-11)6-12(13,14)15/h2-5H,6-8H2,1H3/t11-,18-/m1/s1 |
| InChIKey | AEBUYXFCMZQEIY-ADLMAVQZSA-N |
| XLogP | 2.82 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|