C12H14F2O2S — CID 134928053
(2R)-2-(2,2-difluoroethyl)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxirane (PubChem CID 134928053) has the molecular formula C12H14F2O2S and a molecular weight of 260.31 g/mol. Its IUPAC name is (2R)-2-(2,2-difluoroethyl)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxirane.
| Compound Name | (2R)-2-(2,2-difluoroethyl)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxirane |
|---|---|
| PubChem CID | 134928053 |
| Molecular Formula | C12H14F2O2S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (2R)-2-(2,2-difluoroethyl)-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]oxirane |
| SMILES | Cc1ccc([S@](=O)C[C@@]2(CC(F)F)CO2)cc1 |
| InChI | InChI=1S/C12H14F2O2S/c1-9-2-4-10(5-3-9)17(15)8-12(7-16-12)6-11(13)14/h2-5,11H,6-8H2,1H3/t12-,17-/m1/s1 |
| InChIKey | OZGZAGHRVQONMB-SJKOYZFVSA-N |
| XLogP | 2.53 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|