C13H16F2O3S — CID 163297774
3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-methyloxolane (PubChem CID 163297774) has the molecular formula C13H16F2O3S and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-methyloxolane.
| Compound Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-methyloxolane |
|---|---|
| PubChem CID | 163297774 |
| Molecular Formula | C13H16F2O3S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-methyloxolane |
| SMILES | CC1COCC1CC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H16F2O3S/c1-10-8-18-9-11(10)7-13(14,15)19(16,17)12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3 |
| InChIKey | AHEFRPIKJWRFPY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |