C13H15F2IO3S — CID 135062272
3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-(iodomethyl)oxolane (PubChem CID 135062272) has the molecular formula C13H15F2IO3S and a molecular weight of 416.23 g/mol. Its IUPAC name is 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-(iodomethyl)oxolane.
| Compound Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-(iodomethyl)oxolane |
|---|---|
| PubChem CID | 135062272 |
| Molecular Formula | C13H15F2IO3S |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | 3-[2-(benzenesulfonyl)-2,2-difluoroethyl]-4-(iodomethyl)oxolane |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)CC1COCC1CI |
| InChI | InChI=1S/C13H15F2IO3S/c14-13(15,6-10-8-19-9-11(10)7-16)20(17,18)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2 |
| InChIKey | RHPRYNAVQPCQLP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|