C11H11F3O3S — CID 151091108
3-[3-(trifluoromethyl)phenyl]sulfonyloxolane (PubChem CID 151091108) has the molecular formula C11H11F3O3S and a molecular weight of 280.27 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]sulfonyloxolane.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]sulfonyloxolane |
|---|---|
| PubChem CID | 151091108 |
| Molecular Formula | C11H11F3O3S |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]sulfonyloxolane |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)C1CCOC1 |
| InChI | InChI=1S/C11H11F3O3S/c12-11(13,14)8-2-1-3-9(6-8)18(15,16)10-4-5-17-7-10/h1-3,6,10H,4-5,7H2 |
| InChIKey | MMDMMCFCXKRCFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |