C12H12F4OS — CID 102132779
3-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)oxolane (PubChem CID 102132779) has the molecular formula C12H12F4OS and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)oxolane.
| Compound Name | 3-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)oxolane |
|---|---|
| PubChem CID | 102132779 |
| Molecular Formula | C12H12F4OS |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 3-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)oxolane |
| SMILES | FC(F)(Sc1ccccc1)C(F)(F)C1CCOC1 |
| InChI | InChI=1S/C12H12F4OS/c13-11(14,9-6-7-17-8-9)12(15,16)18-10-4-2-1-3-5-10/h1-5,9H,6-8H2 |
| InChIKey | HNMKQINXLSCDLA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|