C12H13F5OS — CID 162413512
1-fluoro-4-[3-(2,2,3,3-tetrafluoropropoxy)propylsulfanyl]benzene (PubChem CID 162413512) has the molecular formula C12H13F5OS and a molecular weight of 300.29 g/mol. Its IUPAC name is 1-fluoro-4-[3-(2,2,3,3-tetrafluoropropoxy)propylsulfanyl]benzene.
| Compound Name | 1-fluoro-4-[3-(2,2,3,3-tetrafluoropropoxy)propylsulfanyl]benzene |
|---|---|
| PubChem CID | 162413512 |
| Molecular Formula | C12H13F5OS |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-fluoro-4-[3-(2,2,3,3-tetrafluoropropoxy)propylsulfanyl]benzene |
| SMILES | Fc1ccc(SCCCOCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H13F5OS/c13-9-2-4-10(5-3-9)19-7-1-6-18-8-12(16,17)11(14)15/h2-5,11H,1,6-8H2 |
| InChIKey | JULIEGCHUYDCMR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|