C9H6F6S — CID 12567444
1,1,1,3,3,3-hexafluoropropan-2-ylsulfanylbenzene (PubChem CID 12567444) has the molecular formula C9H6F6S and a molecular weight of 260.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-ylsulfanylbenzene.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-ylsulfanylbenzene |
|---|---|
| PubChem CID | 12567444 |
| Molecular Formula | C9H6F6S |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-ylsulfanylbenzene |
| SMILES | FC(F)(F)C(Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H6F6S/c10-8(11,12)7(9(13,14)15)16-6-4-2-1-3-5-6/h1-5,7H |
| InChIKey | BPSMVSJDJAFEIC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |