C28H22F6GeOS — CID 10031381
1,1,1,3,3,3-hexafluoro-2-[phenylsulfanyl(triphenylgermyl)methyl]propan-2-ol (PubChem CID 10031381) has the molecular formula C28H22F6GeOS and a molecular weight of 593.15 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[phenylsulfanyl(triphenylgermyl)methyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[phenylsulfanyl(triphenylgermyl)methyl]propan-2-ol |
|---|---|
| PubChem CID | 10031381 |
| Molecular Formula | C28H22F6GeOS |
| Molecular Weight | 593.15 g/mol |
| Exact Mass | 594.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[phenylsulfanyl(triphenylgermyl)methyl]propan-2-ol |
| SMILES | OC(C(Sc1ccccc1)[Ge](c1ccccc1)(c1ccccc1)c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H22F6GeOS/c29-27(30,31)26(36,28(32,33)34)25(37-24-19-11-4-12-20-24)35(21-13-5-1-6-14-21,22-15-7-2-8-16-22)23-17-9-3-10-18-23/h1-20,25,36H |
| InChIKey | QIMPBDYLRKJSEP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.15 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |