C13H10F12O2 — CID 157119135
1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol (PubChem CID 157119135) has the molecular formula C13H10F12O2 and a molecular weight of 426.20 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 157119135 |
| Molecular Formula | C13H10F12O2 |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-methylpropan-2-ol;1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-ol |
| SMILES | CC(O)(C(F)(F)F)C(F)(F)F.OC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6F6O.C4H4F6O/c10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6;1-2(11,3(5,6)7)4(8,9)10/h1-5,16H;11H,1H3 |
| InChIKey | AHTHCKLMYAKJCW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |