C16H11F5O2 — CID 10520428
2,2,4,4,4-pentafluoro-3-hydroxy-1,3-diphenylbutan-1-one (PubChem CID 10520428) has the molecular formula C16H11F5O2 and a molecular weight of 330.25 g/mol. Its IUPAC name is 2,2,4,4,4-pentafluoro-3-hydroxy-1,3-diphenylbutan-1-one.
| Compound Name | 2,2,4,4,4-pentafluoro-3-hydroxy-1,3-diphenylbutan-1-one |
|---|---|
| PubChem CID | 10520428 |
| Molecular Formula | C16H11F5O2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2,2,4,4,4-pentafluoro-3-hydroxy-1,3-diphenylbutan-1-one |
| SMILES | O=C(c1ccccc1)C(F)(F)C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H11F5O2/c17-15(18,13(22)11-7-3-1-4-8-11)14(23,16(19,20)21)12-9-5-2-6-10-12/h1-10,23H |
| InChIKey | WATWSFGFTHSRNC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |