C28H22F6O2 — CID 158244251
diphenylmethanone;fluoroform;2,2,2-trifluoro-1,1-diphenylethanol (PubChem CID 158244251) has the molecular formula C28H22F6O2 and a molecular weight of 504.47 g/mol. Its IUPAC name is diphenylmethanone;fluoroform;2,2,2-trifluoro-1,1-diphenylethanol.
| Compound Name | diphenylmethanone;fluoroform;2,2,2-trifluoro-1,1-diphenylethanol |
|---|---|
| PubChem CID | 158244251 |
| Molecular Formula | C28H22F6O2 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | diphenylmethanone;fluoroform;2,2,2-trifluoro-1,1-diphenylethanol |
| SMILES | FC(F)F.O=C(c1ccccc1)c1ccccc1.OC(c1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H11F3O.C13H10O.CHF3/c15-14(16,17)13(18,11-7-3-1-4-8-11)12-9-5-2-6-10-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;2-1(3)4/h1-10,18H;1-10H;1H |
| InChIKey | GFXSFYWZLIHIML-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |