C12H9F3OS — CID 10611204
2,2,2-trifluoro-1-phenyl-1-thiophen-3-ylethanol (PubChem CID 10611204) has the molecular formula C12H9F3OS and a molecular weight of 258.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-phenyl-1-thiophen-3-ylethanol.
| Compound Name | 2,2,2-trifluoro-1-phenyl-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 10611204 |
| Molecular Formula | C12H9F3OS |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 2,2,2-trifluoro-1-phenyl-1-thiophen-3-ylethanol |
| SMILES | OC(c1ccccc1)(c1ccsc1)C(F)(F)F |
| InChI | InChI=1S/C12H9F3OS/c13-12(14,15)11(16,10-6-7-17-8-10)9-4-2-1-3-5-9/h1-8,16H |
| InChIKey | YWHXLEZVOABOJW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |