C7H8F3NS — CID 131081620
(2R)-1,1,1-trifluoro-2-thiophen-3-ylpropan-2-amine (PubChem CID 131081620) has the molecular formula C7H8F3NS and a molecular weight of 195.21 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-thiophen-3-ylpropan-2-amine.
| Compound Name | (2R)-1,1,1-trifluoro-2-thiophen-3-ylpropan-2-amine |
|---|---|
| PubChem CID | 131081620 |
| Molecular Formula | C7H8F3NS |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-thiophen-3-ylpropan-2-amine |
| SMILES | C[C@@](N)(c1ccsc1)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NS/c1-6(11,7(8,9)10)5-2-3-12-4-5/h2-4H,11H2,1H3/t6-/m1/s1 |
| InChIKey | DMZAFYMEBGCOLX-ZCFIWIBFSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |