C9H11ClF3N — CID 67693696
(2S)-1,1,1-trifluoro-2-phenylpropan-2-amine;hydrochloride (PubChem CID 67693696) has the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-phenylpropan-2-amine;hydrochloride.
| Compound Name | (2S)-1,1,1-trifluoro-2-phenylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 67693696 |
| Molecular Formula | C9H11ClF3N |
| Molecular Weight | 225.64 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-phenylpropan-2-amine;hydrochloride |
| SMILES | C[C@](N)(c1ccccc1)C(F)(F)F.Cl |
| InChI | InChI=1S/C9H10F3N.ClH/c1-8(13,9(10,11)12)7-5-3-2-4-6-7;/h2-6H,13H2,1H3;1H/t8-;/m0./s1 |
| InChIKey | UNACEMBLKCAJJY-QRPNPIFTSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |