C28H31F3 — CID 20557378
1-tert-butyl-4-[1-(4-tert-butylphenyl)-2,2,2-trifluoro-1-phenylethyl]benzene (PubChem CID 20557378) has the molecular formula C28H31F3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-tert-butyl-4-[1-(4-tert-butylphenyl)-2,2,2-trifluoro-1-phenylethyl]benzene.
| Compound Name | 1-tert-butyl-4-[1-(4-tert-butylphenyl)-2,2,2-trifluoro-1-phenylethyl]benzene |
|---|---|
| PubChem CID | 20557378 |
| Molecular Formula | C28H31F3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-tert-butyl-4-[1-(4-tert-butylphenyl)-2,2,2-trifluoro-1-phenylethyl]benzene |
| SMILES | CC(C)(C)c1ccc(C(c2ccccc2)(c2ccc(C(C)(C)C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H31F3/c1-25(2,3)20-12-16-23(17-13-20)27(28(29,30)31,22-10-8-7-9-11-22)24-18-14-21(15-19-24)26(4,5)6/h7-19H,1-6H3 |
| InChIKey | ZMPTYGDQTIFOIL-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|