C33H48 — CID 162197471
(2,2-dimethyl-1,1-diphenylpropyl)benzene;bis(2,2-dimethylpropane) (PubChem CID 162197471) has the molecular formula C33H48 and a molecular weight of 444.75 g/mol. Its IUPAC name is (2,2-dimethyl-1,1-diphenylpropyl)benzene;bis(2,2-dimethylpropane).
| Compound Name | (2,2-dimethyl-1,1-diphenylpropyl)benzene;bis(2,2-dimethylpropane) |
|---|---|
| PubChem CID | 162197471 |
| Molecular Formula | C33H48 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | (2,2-dimethyl-1,1-diphenylpropyl)benzene;bis(2,2-dimethylpropane) |
| SMILES | CC(C)(C)C.CC(C)(C)C.CC(C)(C)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24.2C5H12/c1-22(2,3)23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21;2*1-5(2,3)4/h4-18H,1-3H3;2*1-4H3 |
| InChIKey | ZRDHNLRLFITGQA-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|