C13H22O2 — CID 23026515
hydrogen peroxide;2,3,3-trimethylbutan-2-ylbenzene (PubChem CID 23026515) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is hydrogen peroxide;2,3,3-trimethylbutan-2-ylbenzene.
| Compound Name | hydrogen peroxide;2,3,3-trimethylbutan-2-ylbenzene |
|---|---|
| PubChem CID | 23026515 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | hydrogen peroxide;2,3,3-trimethylbutan-2-ylbenzene |
| SMILES | CC(C)(C)C(C)(C)c1ccccc1.OO |
| InChI | InChI=1S/C13H20.H2O2/c1-12(2,3)13(4,5)11-9-7-6-8-10-11;1-2/h6-10H,1-5H3;1-2H |
| InChIKey | WHZKJGULGPTGIU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|