C16H26 — CID 59630443
2,3,3,4,4-pentamethylpentan-2-ylbenzene (PubChem CID 59630443) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 2,3,3,4,4-pentamethylpentan-2-ylbenzene.
| Compound Name | 2,3,3,4,4-pentamethylpentan-2-ylbenzene |
|---|---|
| PubChem CID | 59630443 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2,3,3,4,4-pentamethylpentan-2-ylbenzene |
| SMILES | CC(C)(C)C(C)(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H26/c1-14(2,3)16(6,7)15(4,5)13-11-9-8-10-12-13/h8-12H,1-7H3 |
| InChIKey | XWCRKVNVVCKHLQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |