C16H16F2 — CID 167184164
(1,1-difluoro-2-methyl-1-phenylpropan-2-yl)benzene (PubChem CID 167184164) has the molecular formula C16H16F2 and a molecular weight of 246.30 g/mol. Its IUPAC name is (1,1-difluoro-2-methyl-1-phenylpropan-2-yl)benzene.
| Compound Name | (1,1-difluoro-2-methyl-1-phenylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 167184164 |
| Molecular Formula | C16H16F2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | (1,1-difluoro-2-methyl-1-phenylpropan-2-yl)benzene |
| SMILES | CC(C)(c1ccccc1)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C16H16F2/c1-15(2,13-9-5-3-6-10-13)16(17,18)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | AVRNMTNUPQLBFK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |