C9H5F6I — CID 163925016
(1,1,2,2,3,3-hexafluoro-3-iodopropyl)benzene (PubChem CID 163925016) has the molecular formula C9H5F6I and a molecular weight of 354.03 g/mol. Its IUPAC name is (1,1,2,2,3,3-hexafluoro-3-iodopropyl)benzene.
| Compound Name | (1,1,2,2,3,3-hexafluoro-3-iodopropyl)benzene |
|---|---|
| PubChem CID | 163925016 |
| Molecular Formula | C9H5F6I |
| Molecular Weight | 354.03 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | (1,1,2,2,3,3-hexafluoro-3-iodopropyl)benzene |
| SMILES | FC(F)(I)C(F)(F)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H5F6I/c10-7(11,6-4-2-1-3-5-6)8(12,13)9(14,15)16/h1-5H |
| InChIKey | RDRLJPQFNRVHIR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.03 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|