C9H6F7O3P — CID 87221955
fluoro-(1,1,2,2,3,3-hexafluoro-3-phenylpropoxy)phosphinic acid (PubChem CID 87221955) has the molecular formula C9H6F7O3P and a molecular weight of 326.10 g/mol. Its IUPAC name is fluoro-(1,1,2,2,3,3-hexafluoro-3-phenylpropoxy)phosphinic acid.
| Compound Name | fluoro-(1,1,2,2,3,3-hexafluoro-3-phenylpropoxy)phosphinic acid |
|---|---|
| PubChem CID | 87221955 |
| Molecular Formula | C9H6F7O3P |
| Molecular Weight | 326.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | fluoro-(1,1,2,2,3,3-hexafluoro-3-phenylpropoxy)phosphinic acid |
| SMILES | O=P(O)(F)OC(F)(F)C(F)(F)C(F)(F)c1ccccc1 |
| InChI | InChI=1S/C9H6F7O3P/c10-7(11,6-4-2-1-3-5-6)8(12,13)9(14,15)19-20(16,17)18/h1-5H,(H,17,18) |
| InChIKey | RDWUCSZHIUUJPQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.10 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|