C20H9F17NaO4P — CID 101423427
sodium [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] phenyl phosphate (PubChem CID 101423427) has the molecular formula C20H9F17NaO4P and a molecular weight of 690.22 g/mol. Its IUPAC name is sodium [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] phenyl phosphate.
| Compound Name | sodium [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] phenyl phosphate |
|---|---|
| PubChem CID | 101423427 |
| Molecular Formula | C20H9F17NaO4P |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.99 |
| IUPAC Name | sodium [4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)phenyl] phenyl phosphate |
| SMILES | O=P([O-])(Oc1ccccc1)Oc1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C20H10F17O4P.Na/c21-13(22,10-6-8-12(9-7-10)41-42(38,39)40-11-4-2-1-3-5-11)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37;/h1-9H,(H,38,39);/q;+1/p-1 |
| InChIKey | LXIOBZQEGRTLLU-UHFFFAOYSA-M |
| XLogP | 5.08 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|