C11H4ClF11O2S — CID 45379920
4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonyl chloride (PubChem CID 45379920) has the molecular formula C11H4ClF11O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonyl chloride.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 45379920 |
| Molecular Formula | C11H4ClF11O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H4ClF11O2S/c12-26(24,25)6-3-1-5(2-4-6)7(13,14)8(15,16)9(17,18)10(19,20)11(21,22)23/h1-4H |
| InChIKey | UWWJMULYOGIJQR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|