C15H3Cl2F15O2 — CID 101056240
5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzene-1,3-dicarbonyl chloride (PubChem CID 101056240) has the molecular formula C15H3Cl2F15O2 and a molecular weight of 571.06 g/mol. Its IUPAC name is 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzene-1,3-dicarbonyl chloride.
| Compound Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 101056240 |
| Molecular Formula | C15H3Cl2F15O2 |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 569.93 |
| IUPAC Name | 5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)benzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc(C(=O)Cl)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H3Cl2F15O2/c16-7(33)4-1-5(8(17)34)3-6(2-4)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)32/h1-3H |
| InChIKey | DOAZFULXVHRLCH-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|